CAS 74380-71-5 appears in our catalog under these names: 3-Propanoylbenzoic acid, 95%, 3-Propionylbenzoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
3-propanoylbenzoic acid (CAS 74380-71-5) is a chemical compound with the molecular formula C10H10O3 and a molecular weight of 178.18 g/mol. IUPAC name: 3-propanoylbenzoic acid. InChIKey: GJXGVUOQOFRNKR-UHFFFAOYSA-N.
| Molecular formula | C10H10O3 |
|---|---|
| Molecular weight | 178.18 g/mol |
| IUPAC name | 3-propanoylbenzoic acid |
| InChIKey | GJXGVUOQOFRNKR-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC(=CC=C1)C(=O)O |
Computed by PubChem (NCBI)