CAS 744183-20-8 appears in our catalog under these names: tert-Butyl exo-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate, 98%, 98%, N-Boc- exo-3-aminotropane, N-Boc- exo-3-aminotropane 98%, N-Boc-exo-1-aminotropane, 97%. Offered by: Chemat, Biosynth, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500mg.
Tert-butyl (1S,5R)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate (CAS 744183-20-8) is a chemical compound with the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. IUPAC name: tert-butyl (1S,5R)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate. InChIKey: NZJKEPNCNBWESN-PBINXNQUSA-N.
| Molecular formula | C12H22N2O2 |
|---|---|
| Molecular weight | 226.32 g/mol |
| IUPAC name | tert-butyl (1S,5R)-3-amino-8-azabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | NZJKEPNCNBWESN-PBINXNQUSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(C2)N |
Computed by PubChem (NCBI)