Products 74443-35-9
CAS 74443-35-9 appears in our catalog under these names: Bis(2，6–dimethylphenyl)amine, Bis(2,6-dimethylphenyl)amine 97%, Bis(2,6-dimethylphenyl)amine, 98%, 98%, Bis(2,6-dimethylphenyl)amine, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 100mg.
N-(2,6-dimethylphenyl)-2,6-dimethylaniline (CAS 74443-35-9) is a chemical compound with the molecular formula C16H19N and a molecular weight of 225.33 g/mol. IUPAC name: N-(2,6-dimethylphenyl)-2,6-dimethylaniline. InChIKey: FQKQCCVYAJVHAF-UHFFFAOYSA-N.
| Molecular formula | C16H19N |
|---|---|
| Molecular weight | 225.33 g/mol |
| IUPAC name | N-(2,6-dimethylphenyl)-2,6-dimethylaniline |
| InChIKey | FQKQCCVYAJVHAF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=C(C=CC=C2C)C |
Computed by PubChem (NCBI)