CAS 74487-85-7 is the registry number for 2,2',3,4',5,6,6'-Heptachlorobiphenyl. Offered by: Biosynth. Available pack sizes: 5ml, 10ml, 25ml, 50ml.
1,2,4,5-tetrachloro-3-(2,4,6-trichlorophenyl)benzene (CAS 74487-85-7) is a chemical compound with the molecular formula C12H3Cl7 and a molecular weight of 395.3 g/mol. IUPAC name: 1,2,4,5-tetrachloro-3-(2,4,6-trichlorophenyl)benzene. InChIKey: MMTJWDQKGUNSDK-UHFFFAOYSA-N.
| Molecular formula | C12H3Cl7 |
|---|---|
| Molecular weight | 395.3 g/mol |
| IUPAC name | 1,2,4,5-tetrachloro-3-(2,4,6-trichlorophenyl)benzene |
| InChIKey | MMTJWDQKGUNSDK-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C2=C(C(=CC(=C2Cl)Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)