CAS 74492-46-9 appears in our catalog under these names: 5-Chloro-3,3-dimethylindolin-2-one, 95%, 5-chloro-3,3-dimethylindolin-2-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 100mg, 10g, 250mg, 5g, 1g.
5-chloro-3,3-dimethyl-1H-indol-2-one (CAS 74492-46-9) is a chemical compound with the molecular formula C10H10ClNO and a molecular weight of 195.64 g/mol. IUPAC name: 5-chloro-3,3-dimethyl-1H-indol-2-one. InChIKey: IGGUFOCFQMEIGO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO |
|---|---|
| Molecular weight | 195.64 g/mol |
| IUPAC name | 5-chloro-3,3-dimethyl-1H-indol-2-one |
| InChIKey | IGGUFOCFQMEIGO-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)Cl)NC1=O)C |
Computed by PubChem (NCBI)