Products 745048-63-9
CAS 745048-63-9 appears in our catalog under these names: 5-amino-2-bromo-4-methylbenzoic acid, 97%, 5–Amino–2–bromo–4–methylbenzoic acid, 5-Amino-2-bromo-4-methylbenzoic acid, 5-Amino-2-bromo-4-methylbenzoic acid, 95%, 95%, 5-Amino-2-bromo-4-methylbenzoic acid, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 10g, 2,5g, 100mg.
5-amino-2-bromo-4-methylbenzoic acid (CAS 745048-63-9) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 5-amino-2-bromo-4-methylbenzoic acid. InChIKey: WXEDVFCZCKWBCL-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 5-amino-2-bromo-4-methylbenzoic acid |
| InChIKey | WXEDVFCZCKWBCL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)C(=O)O)Br |
Computed by PubChem (NCBI)