CAS 74556-86-8 is the registry number for 5-(2,6-Dichlorophenoxymethyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-[(2,6-dichlorophenoxy)methyl]thiophene-2-carboxylic acid (CAS 74556-86-8) is a chemical compound with the molecular formula C12H8Cl2O3S and a molecular weight of 303.2 g/mol. IUPAC name: 5-[(2,6-dichlorophenoxy)methyl]thiophene-2-carboxylic acid. InChIKey: LEPIPUATYXXCQK-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O3S |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 5-[(2,6-dichlorophenoxy)methyl]thiophene-2-carboxylic acid |
| InChIKey | LEPIPUATYXXCQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC2=CC=C(S2)C(=O)O)Cl |
Computed by PubChem (NCBI)