Products 74556-86-8

CAS 74556-86-8 is the registry number for 5-(2,6-Dichlorophenoxymethyl)thiophene-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

5-[(2,6-dichlorophenoxy)methyl]thiophene-2-carboxylic acid (CAS 74556-86-8) is a chemical compound with the molecular formula C12H8Cl2O3S and a molecular weight of 303.2 g/mol. IUPAC name: 5-[(2,6-dichlorophenoxy)methyl]thiophene-2-carboxylic acid. InChIKey: LEPIPUATYXXCQK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Cl2O3S
Molecular weight303.2 g/mol
IUPAC name5-[(2,6-dichlorophenoxy)methyl]thiophene-2-carboxylic acid
InChIKeyLEPIPUATYXXCQK-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)Cl)OCC2=CC=C(S2)C(=O)O)Cl

Computed by PubChem (NCBI)