Products 815576-24-0

CAS 815576-24-0 appears in our catalog under these names: 4-(3-Chlorophenoxy)benzene-1-sulfonyl chloride, 95%, 4-(3-Chlorophenoxy)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

4-(3-chlorophenoxy)benzenesulfonyl chloride (CAS 815576-24-0) is a chemical compound with the molecular formula C12H8Cl2O3S and a molecular weight of 303.2 g/mol. IUPAC name: 4-(3-chlorophenoxy)benzenesulfonyl chloride. InChIKey: JNMIOFCTTBBMJG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H8Cl2O3S
Molecular weight303.2 g/mol
IUPAC name4-(3-chlorophenoxy)benzenesulfonyl chloride
InChIKeyJNMIOFCTTBBMJG-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)OC2=CC=C(C=C2)S(=O)(=O)Cl

Computed by PubChem (NCBI)