CAS 97-16-5 appears in our catalog under these names: Genite, 95%, 2,4-Dichlorophenyl benzenesulphonate, Genite, Genite, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, MedChemExpress, HPC Standards. Available pack sizes: 5g, 250mg, 1g, 500mg, Get quote, 1x1ml, 1x250mg.
(2,4-dichlorophenyl) benzenesulfonate (CAS 97-16-5) is a chemical compound with the molecular formula C12H8Cl2O3S and a molecular weight of 303.2 g/mol. IUPAC name: (2,4-dichlorophenyl) benzenesulfonate. InChIKey: OZFAFGSSMRRTDW-UHFFFAOYSA-N.
| Molecular formula | C12H8Cl2O3S |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | (2,4-dichlorophenyl) benzenesulfonate |
| InChIKey | OZFAFGSSMRRTDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)OC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)