Products 74563-01-2
CAS 74563-01-2 appears in our catalog under these names: Benzhydrol-d10, Diphenylmethanol-d10. Offered by: TRC, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, Get quote.
Bis(2,3,4,5,6-pentadeuteriophenyl)methanol (CAS 74563-01-2) is a chemical compound with the molecular formula C13H12O and a molecular weight of 194.29 g/mol. IUPAC name: bis(2,3,4,5,6-pentadeuteriophenyl)methanol. InChIKey: QILSFLSDHQAZET-LHNTUAQVSA-N.
| Molecular formula | C13H12O |
|---|---|
| Molecular weight | 194.29 g/mol |
| IUPAC name | bis(2,3,4,5,6-pentadeuteriophenyl)methanol |
| InChIKey | QILSFLSDHQAZET-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])O)[2H])[2H] |
Computed by PubChem (NCBI)