Products 74589-79-0
CAS 74589-79-0 is the registry number for Cilastatin Sodium Impurity CPEA. Offered by: TRC. Available pack sizes: 100mg.
(Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-7-hydroxyhept-2-enoic acid (CAS 74589-79-0) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-7-hydroxyhept-2-enoic acid. InChIKey: MBPLVKSQPJNGMB-WPVMNKCKSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | (Z)-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]-7-hydroxyhept-2-enoic acid |
| InChIKey | MBPLVKSQPJNGMB-WPVMNKCKSA-N |
| SMILES | CC1(C[C@@H]1C(=O)N/C(=C\CCCCO)/C(=O)O)C |
Computed by PubChem (NCBI)