Products 746610-46-8
CAS 746610-46-8 is the registry number for 2-Chloro-5-(hydrazinecarbonyl)-N-(2-methoxyphenyl)benzene-1-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 5g.
2-chloro-5-(hydrazinecarbonyl)-N-(2-methoxyphenyl)benzenesulfonamide (CAS 746610-46-8) is a chemical compound with the molecular formula C14H14ClN3O4S and a molecular weight of 355.8 g/mol. IUPAC name: 2-chloro-5-(hydrazinecarbonyl)-N-(2-methoxyphenyl)benzenesulfonamide. InChIKey: RDFNYXUIBIGZAZ-UHFFFAOYSA-N.
| Molecular formula | C14H14ClN3O4S |
|---|---|
| Molecular weight | 355.8 g/mol |
| IUPAC name | 2-chloro-5-(hydrazinecarbonyl)-N-(2-methoxyphenyl)benzenesulfonamide |
| InChIKey | RDFNYXUIBIGZAZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1NS(=O)(=O)C2=C(C=CC(=C2)C(=O)NN)Cl |
Computed by PubChem (NCBI)