CAS 7467-12-1 is the registry number for 2,4-Dimethylbenzenesulfonamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
2,4-dimethylbenzenesulfonamide (CAS 7467-12-1) is a chemical compound with the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. IUPAC name: 2,4-dimethylbenzenesulfonamide. InChIKey: UGBKWMBOBQOCSS-UHFFFAOYSA-N.
| Molecular formula | C8H11NO2S |
|---|---|
| Molecular weight | 185.25 g/mol |
| IUPAC name | 2,4-dimethylbenzenesulfonamide |
| InChIKey | UGBKWMBOBQOCSS-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)N)C |
Computed by PubChem (NCBI)