Products 74730-10-2
CAS 74730-10-2 is the registry number for Pterolactone A. Offered by: MedChemExpress. Available pack sizes: Get quote.
(8R)-8-hydroxy-5,7,7-trimethyl-4,8-dihydro-3H-cyclopenta[g]isochromene-1,6-dione (CAS 74730-10-2) is a chemical compound with the molecular formula C15H16O4 and a molecular weight of 260.28 g/mol. IUPAC name: (8R)-8-hydroxy-5,7,7-trimethyl-4,8-dihydro-3H-cyclopenta[g]isochromene-1,6-dione. InChIKey: QEXKRFPEOUYPOW-GFCCVEGCSA-N.
| Molecular formula | C15H16O4 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | (8R)-8-hydroxy-5,7,7-trimethyl-4,8-dihydro-3H-cyclopenta[g]isochromene-1,6-dione |
| InChIKey | QEXKRFPEOUYPOW-GFCCVEGCSA-N |
| SMILES | CC1=C2C(=CC3=C1CCOC3=O)[C@H](C(C2=O)(C)C)O |
Computed by PubChem (NCBI)