CAS 749205-02-5 appears in our catalog under these names: 2-((4S)-2-Oxo-1,3-oxazolidin-4-yl)acetic acid, 95%, 2-((4S)-2-Oxo-1,3-oxazolidin-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetic acid (CAS 749205-02-5) is a chemical compound with the molecular formula C5H7NO4 and a molecular weight of 145.11 g/mol. IUPAC name: 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetic acid. InChIKey: UNTORHUZEPTHGB-VKHMYHEASA-N.
| Molecular formula | C5H7NO4 |
|---|---|
| Molecular weight | 145.11 g/mol |
| IUPAC name | 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]acetic acid |
| InChIKey | UNTORHUZEPTHGB-VKHMYHEASA-N |
| SMILES | C1[C@@H](NC(=O)O1)CC(=O)O |
Computed by PubChem (NCBI)