CAS 749219-34-9 is the registry number for 2-Benzyl-4-(ethoxymethylidene)-1,2,3,4-tetrahydroisoquinoline-1,3-dione, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
(4Z)-2-benzyl-4-(ethoxymethylidene)isoquinoline-1,3-dione (CAS 749219-34-9) is a chemical compound with the molecular formula C19H17NO3 and a molecular weight of 307.3 g/mol. IUPAC name: (4Z)-2-benzyl-4-(ethoxymethylidene)isoquinoline-1,3-dione. InChIKey: LJYCJDJVXUPFFP-LGMDPLHJSA-N.
| Molecular formula | C19H17NO3 |
|---|---|
| Molecular weight | 307.3 g/mol |
| IUPAC name | (4Z)-2-benzyl-4-(ethoxymethylidene)isoquinoline-1,3-dione |
| InChIKey | LJYCJDJVXUPFFP-LGMDPLHJSA-N |
| SMILES | CCO/C=C\1/C2=CC=CC=C2C(=O)N(C1=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)