Products 7494-76-0
CAS 7494-76-0 appears in our catalog under these names: 4-Phenylcyclohexanecarboxylic acid, 4-Phenylcyclohexanecarboxylic acid, 97%, 4-Phenylcyclohexane-1-carboxylic acid, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 250mg, 100mg, 500mg, 1g, 5g, 10g, 25g.
4-phenylcyclohexane-1-carboxylic acid (CAS 7494-76-0) is a chemical compound with the molecular formula C13H16O2 and a molecular weight of 204.26 g/mol. IUPAC name: 4-phenylcyclohexane-1-carboxylic acid. InChIKey: SYYSTPDYCASVSQ-UHFFFAOYSA-N.
| Molecular formula | C13H16O2 |
|---|---|
| Molecular weight | 204.26 g/mol |
| IUPAC name | 4-phenylcyclohexane-1-carboxylic acid |
| InChIKey | SYYSTPDYCASVSQ-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Phenyl-cyclohexanecarboxylic acid, 4-Phenylcyclohexanecarboxylic acid, 4-phenylcyclohexane-1-carboxylic acid, trans-4-Phenylcyclohexanecarboxylic acid, trans-4-henylcyclohexanecarboxylic acid, Atovaquone Impurity 23, Cyclohexanecarboxylic acid, 4-phenyl-, trans-, Cambridge id 5301879, (1r,4r)-4-Phenylcyclohexane-1-carboxylic acid, Oprea1_230010