CAS 7496-56-2 appears in our catalog under these names: 4-benzyl-1,3-thiazol-2-amine, 4-Benzyl-1,3-thiazol-2-amine, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 1g, 100mg, 250mg, 5g.
4-benzyl-1,3-thiazol-2-amine (CAS 7496-56-2) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 4-benzyl-1,3-thiazol-2-amine. InChIKey: FDUDPXVHCZKIOJ-UHFFFAOYSA-N.
| Molecular formula | C10H10N2S |
|---|---|
| Molecular weight | 190.27 g/mol |
| IUPAC name | 4-benzyl-1,3-thiazol-2-amine |
| InChIKey | FDUDPXVHCZKIOJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CSC(=N2)N |
Computed by PubChem (NCBI)