Products 749920-38-5
CAS 749920-38-5 appears in our catalog under these names: 2-[2-(Furan-2-yl)-2-oxoethylidene]-1,3-thiazolidin-4-one, 95%, 2-(2-(Furan-2-yl)-2-oxoethylidene)-1,3-thiazolidin-4-one, 95%, 2-(2-(Furan-2-yl)-2-oxoethylidene)-1,3-thiazolidin-4-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(2Z)-2-[2-(furan-2-yl)-2-oxoethylidene]-1,3-thiazolidin-4-one (CAS 749920-38-5) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: (2Z)-2-[2-(furan-2-yl)-2-oxoethylidene]-1,3-thiazolidin-4-one. InChIKey: XALRCXXRWJXPSZ-WTKPLQERSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | (2Z)-2-[2-(furan-2-yl)-2-oxoethylidene]-1,3-thiazolidin-4-one |
| InChIKey | XALRCXXRWJXPSZ-WTKPLQERSA-N |
| SMILES | C1C(=O)N/C(=C/C(=O)C2=CC=CO2)/S1 |
Computed by PubChem (NCBI)