CAS 213685-54-2 is the registry number for Methyl 2-sulfanylidene-3H-1,3-benzoxazole-4-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Methyl 2-sulfanylidene-3H-1,3-benzoxazole-4-carboxylate (CAS 213685-54-2) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: methyl 2-sulfanylidene-3H-1,3-benzoxazole-4-carboxylate. InChIKey: AZOPGMJDMFFCGR-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | methyl 2-sulfanylidene-3H-1,3-benzoxazole-4-carboxylate |
| InChIKey | AZOPGMJDMFFCGR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C1)OC(=S)N2 |
Computed by PubChem (NCBI)