CAS 22514-57-4 appears in our catalog under these names: 2-Methoxy-1,3-benzothiazole-6-carboxylic acid, 96%, 2-Methoxybenzo(d)thiazole-6-carboxylic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-methoxy-1,3-benzothiazole-6-carboxylic acid (CAS 22514-57-4) is a chemical compound with the molecular formula C9H7NO3S and a molecular weight of 209.22 g/mol. IUPAC name: 2-methoxy-1,3-benzothiazole-6-carboxylic acid. InChIKey: WICVRQPTGYHIHD-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3S |
|---|---|
| Molecular weight | 209.22 g/mol |
| IUPAC name | 2-methoxy-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | WICVRQPTGYHIHD-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(S1)C=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)