CAS 75001-54-6 is the registry number for Ethyl 7-chloro-8-fluoro-4-hydroxyquinoline-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g.
Ethyl 7-chloro-8-fluoro-4-oxo-1H-quinoline-3-carboxylate (CAS 75001-54-6) is a chemical compound with the molecular formula C12H9ClFNO3 and a molecular weight of 269.65 g/mol. IUPAC name: ethyl 7-chloro-8-fluoro-4-oxo-1H-quinoline-3-carboxylate. InChIKey: XXWWLKWICXFXQR-UHFFFAOYSA-N.
| Molecular formula | C12H9ClFNO3 |
|---|---|
| Molecular weight | 269.65 g/mol |
| IUPAC name | ethyl 7-chloro-8-fluoro-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | XXWWLKWICXFXQR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=CC(=C2F)Cl |
Computed by PubChem (NCBI)