Products 75001-54-6

CAS 75001-54-6 is the registry number for Ethyl 7-chloro-8-fluoro-4-hydroxyquinoline-3-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 0,25g, 1g, 2g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 7-chloro-8-fluoro-4-oxo-1H-quinoline-3-carboxylate (CAS 75001-54-6) is a chemical compound with the molecular formula C12H9ClFNO3 and a molecular weight of 269.65 g/mol. IUPAC name: ethyl 7-chloro-8-fluoro-4-oxo-1H-quinoline-3-carboxylate. InChIKey: XXWWLKWICXFXQR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H9ClFNO3
Molecular weight269.65 g/mol
IUPAC nameethyl 7-chloro-8-fluoro-4-oxo-1H-quinoline-3-carboxylate
InChIKeyXXWWLKWICXFXQR-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CNC2=C(C1=O)C=CC(=C2F)Cl

Computed by PubChem (NCBI)