Products 75075-24-0
CAS 75075-24-0 is the registry number for 4'-Dimethylamino-nicotinanilide. Offered by: TRC. Available pack sizes: 5g.
N-[4-(dimethylamino)phenyl]pyridine-3-carboxamide (CAS 75075-24-0) is a chemical compound with the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. IUPAC name: N-[4-(dimethylamino)phenyl]pyridine-3-carboxamide. InChIKey: BJTLNKIQWVAXPC-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O |
|---|---|
| Molecular weight | 241.29 g/mol |
| IUPAC name | N-[4-(dimethylamino)phenyl]pyridine-3-carboxamide |
| InChIKey | BJTLNKIQWVAXPC-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)NC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)