CAS 75105-48-5 is the registry number for Bis(mesityl)-formamidine . Offered by: Chemat Brand. Available pack sizes: 5g, 25g, 100g.
N,N'-bis(2,4,6-trimethylphenyl)methanimidamide (CAS 75105-48-5) is a chemical compound with the molecular formula C19H24N2 and a molecular weight of 280.4 g/mol. IUPAC name: N,N'-bis(2,4,6-trimethylphenyl)methanimidamide. InChIKey: VSPPKNZKMVKGNX-UHFFFAOYSA-N.
| Molecular formula | C19H24N2 |
|---|---|
| Molecular weight | 280.4 g/mol |
| IUPAC name | N,N'-bis(2,4,6-trimethylphenyl)methanimidamide |
| InChIKey | VSPPKNZKMVKGNX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NC=NC2=C(C=C(C=C2C)C)C)C |
Computed by PubChem (NCBI)