CAS 75107-16-3 is the registry number for Benzyl 2-bromo-2-methylpropanoate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Benzyl 2-bromo-2-methylpropanoate (CAS 75107-16-3) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: benzyl 2-bromo-2-methylpropanoate. InChIKey: BJCBXEQGZMWAQO-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | benzyl 2-bromo-2-methylpropanoate |
| InChIKey | BJCBXEQGZMWAQO-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)OCC1=CC=CC=C1)Br |
Computed by PubChem (NCBI)