CAS 7511-14-0 appears in our catalog under these names: N,N-Dimethyl-1H-indole-2-carboxamide, 97%, N’,N’-Dimethylindole-2-carboxamide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 500mg.
N,N-dimethyl-1H-indole-2-carboxamide (CAS 7511-14-0) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: N,N-dimethyl-1H-indole-2-carboxamide. InChIKey: AYVIZFVTRRWODF-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | N,N-dimethyl-1H-indole-2-carboxamide |
| InChIKey | AYVIZFVTRRWODF-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC2=CC=CC=C2N1 |
Computed by PubChem (NCBI)