CAS 75116-67-5 appears in our catalog under these names: 5-Nitro-1-Phenyl-1H-benzo[d][1,2,3]triazole, 97%, 97%, 5-Nitro-1-phenyl-1H-benzo[d][1,2,3]triazole, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-nitro-1-phenylbenzotriazole (CAS 75116-67-5) is a chemical compound with the molecular formula C12H8N4O2 and a molecular weight of 240.22 g/mol. IUPAC name: 5-nitro-1-phenylbenzotriazole. InChIKey: FCKVYRYQUBHSSE-UHFFFAOYSA-N.
| Molecular formula | C12H8N4O2 |
|---|---|
| Molecular weight | 240.22 g/mol |
| IUPAC name | 5-nitro-1-phenylbenzotriazole |
| InChIKey | FCKVYRYQUBHSSE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C3=C(C=C(C=C3)[N+](=O)[O-])N=N2 |
Computed by PubChem (NCBI)