Products 75198-13-9
CAS 75198-13-9 is the registry number for 1-Fluoro-2-methyl-1-phenylpropan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-fluoro-2-methyl-1-phenylpropan-2-amine;hydrochloride (CAS 75198-13-9) is a chemical compound with the molecular formula C10H15ClFN and a molecular weight of 203.68 g/mol. IUPAC name: 1-fluoro-2-methyl-1-phenylpropan-2-amine;hydrochloride. InChIKey: SGWJHJGWYJWSSE-UHFFFAOYSA-N.
| Molecular formula | C10H15ClFN |
|---|---|
| Molecular weight | 203.68 g/mol |
| IUPAC name | 1-fluoro-2-methyl-1-phenylpropan-2-amine;hydrochloride |
| InChIKey | SGWJHJGWYJWSSE-UHFFFAOYSA-N |
| SMILES | CC(C)(C(C1=CC=CC=C1)F)N.Cl |
Computed by PubChem (NCBI)