CAS 75300-63-9 is the registry number for N-(2,3-Dimethylphenyl)-2-hydroxybenzamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,3-dimethylphenyl)-2-hydroxybenzamide (CAS 75300-63-9) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: N-(2,3-dimethylphenyl)-2-hydroxybenzamide. InChIKey: BRCULNLBELTSHR-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | N-(2,3-dimethylphenyl)-2-hydroxybenzamide |
| InChIKey | BRCULNLBELTSHR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)NC(=O)C2=CC=CC=C2O)C |
Computed by PubChem (NCBI)