Products 753428-82-9

CAS 753428-82-9 is the registry number for 3-Phenylprop-2-yn-1-yl carbamimidothioate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-phenylprop-2-ynyl carbamimidothioate (CAS 753428-82-9) is a chemical compound with the molecular formula C10H10N2S and a molecular weight of 190.27 g/mol. IUPAC name: 3-phenylprop-2-ynyl carbamimidothioate. InChIKey: ACHBVRKFCYBXSQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10N2S
Molecular weight190.27 g/mol
IUPAC name3-phenylprop-2-ynyl carbamimidothioate
InChIKeyACHBVRKFCYBXSQ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C#CCSC(=N)N

Computed by PubChem (NCBI)