CAS 75380-54-0 is the registry number for 1-(2,4-Dimethyl-4H-pyrazolo(1,5-a)benzimidazol-3-yl)ethanone. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2,4-dimethylpyrazolo[1,5-a]benzimidazol-3-yl)ethanone (CAS 75380-54-0) is a chemical compound with the molecular formula C13H13N3O and a molecular weight of 227.26 g/mol. IUPAC name: 1-(2,4-dimethylpyrazolo[1,5-a]benzimidazol-3-yl)ethanone. InChIKey: HXUOBVIVDMTQLB-UHFFFAOYSA-N.
| Molecular formula | C13H13N3O |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 1-(2,4-dimethylpyrazolo[1,5-a]benzimidazol-3-yl)ethanone |
| InChIKey | HXUOBVIVDMTQLB-UHFFFAOYSA-N |
| SMILES | CC1=NN2C3=CC=CC=C3N(C2=C1C(=O)C)C |
Computed by PubChem (NCBI)