CAS 7544-57-2 is the registry number for 3,5-Diisopropylaniline, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3,5-di(propan-2-yl)aniline (CAS 7544-57-2) is a chemical compound with the molecular formula C12H19N and a molecular weight of 177.29 g/mol. IUPAC name: 3,5-di(propan-2-yl)aniline. InChIKey: HGOAOVKVNRTSSQ-UHFFFAOYSA-N.
| Molecular formula | C12H19N |
|---|---|
| Molecular weight | 177.29 g/mol |
| IUPAC name | 3,5-di(propan-2-yl)aniline |
| InChIKey | HGOAOVKVNRTSSQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)N)C(C)C |
Computed by PubChem (NCBI)