CAS 75457-13-5 appears in our catalog under these names: 3-Methyl-8-hydroxyquinoline, 3–Methylquinolin–8–ol, 3-Methylquinolin-8-ol, 97%, 97%, 3-Methylquinolin-8-ol, 97%. Offered by: TRC, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
3-methylquinolin-8-ol (CAS 75457-13-5) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 3-methylquinolin-8-ol. InChIKey: LHPOFWYKNOUJJN-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 3-methylquinolin-8-ol |
| InChIKey | LHPOFWYKNOUJJN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=CC=C2)O)N=C1 |
Computed by PubChem (NCBI)