CAS 75494-88-1 is the registry number for rac-(4aR,9bS)-2,8-Dimethyl-1H,2H,3H,4H,4aH,5H,9bh-pyrido(4,3-b)indole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(4aR,9bS)-2,8-dimethyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole (CAS 75494-88-1) is a chemical compound with the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. IUPAC name: (4aR,9bS)-2,8-dimethyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole. InChIKey: CYJQCYXRNNCURD-DGCLKSJQSA-N.
| Molecular formula | C13H18N2 |
|---|---|
| Molecular weight | 202.30 g/mol |
| IUPAC name | (4aR,9bS)-2,8-dimethyl-1,3,4,4a,5,9b-hexahydropyrido[4,3-b]indole |
| InChIKey | CYJQCYXRNNCURD-DGCLKSJQSA-N |
| SMILES | CC1=CC2=C(C=C1)N[C@H]3[C@@H]2CN(CC3)C |
Computed by PubChem (NCBI)