CAS 755-40-8 appears in our catalog under these names: 3,3,4,4,5,5,5-Heptafluoropentan-1-ol, 97%, 3,3,4,4,5,5,5-Heptafluoro-1-pentanol, 3,3,4,4,5,5,5-Heptafluoropentan-1-ol 97%, 3,3,4,4,5,5,5-Heptafluoropentan-1-ol, ≥97%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 5g, 1g, 2,5g, 10g, 250mg.
3,3,4,4,5,5,5-heptafluoropentan-1-ol (CAS 755-40-8) is a chemical compound with the molecular formula C5H5F7O and a molecular weight of 214.08 g/mol. IUPAC name: 3,3,4,4,5,5,5-heptafluoropentan-1-ol. InChIKey: ROTSWXZIBBJEPH-UHFFFAOYSA-N.
| Molecular formula | C5H5F7O |
|---|---|
| Molecular weight | 214.08 g/mol |
| IUPAC name | 3,3,4,4,5,5,5-heptafluoropentan-1-ol |
| InChIKey | ROTSWXZIBBJEPH-UHFFFAOYSA-N |
| SMILES | C(CO)C(C(C(F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)