CAS 85571-83-1 is the registry number for 3,3,4,4,5,5,5-Heptafluoropentan-2-ol, 97%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
(2R)-3,3,4,4,5,5,5-heptafluoropentan-2-ol (CAS 85571-83-1) is a chemical compound with the molecular formula C5H5F7O and a molecular weight of 214.08 g/mol. IUPAC name: (2R)-3,3,4,4,5,5,5-heptafluoropentan-2-ol. InChIKey: RBPHBIMHZSTIDT-UWTATZPHSA-N.
| Molecular formula | C5H5F7O |
|---|---|
| Molecular weight | 214.08 g/mol |
| IUPAC name | (2R)-3,3,4,4,5,5,5-heptafluoropentan-2-ol |
| InChIKey | RBPHBIMHZSTIDT-UWTATZPHSA-N |
| SMILES | C[C@H](C(C(C(F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)