Products 90999-87-4
CAS 90999-87-4 is the registry number for 3,4,4,4-Tetrafluoro-3-(trifluoromethyl)butan-1-ol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 25g, 250mg, 1g.
3,4,4,4-tetrafluoro-3-(trifluoromethyl)butan-1-ol (CAS 90999-87-4) is a chemical compound with the molecular formula C5H5F7O and a molecular weight of 214.08 g/mol. IUPAC name: 3,4,4,4-tetrafluoro-3-(trifluoromethyl)butan-1-ol. InChIKey: KKVIDVONCZYZLR-UHFFFAOYSA-N.
| Molecular formula | C5H5F7O |
|---|---|
| Molecular weight | 214.08 g/mol |
| IUPAC name | 3,4,4,4-tetrafluoro-3-(trifluoromethyl)butan-1-ol |
| InChIKey | KKVIDVONCZYZLR-UHFFFAOYSA-N |
| SMILES | C(CO)C(C(F)(F)F)(C(F)(F)F)F |
Computed by PubChem (NCBI)