Products 755036-45-4
CAS 755036-45-4 is the registry number for Dichotomine C. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylate (CAS 755036-45-4) is a chemical compound with the molecular formula C15H14N2O4 and a molecular weight of 286.28 g/mol. IUPAC name: methyl 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: WKUVQUIYZHZZFT-LBPRGKRZSA-N.
| Molecular formula | C15H14N2O4 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | methyl 1-[(1R)-1,2-dihydroxyethyl]-9H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | WKUVQUIYZHZZFT-LBPRGKRZSA-N |
| SMILES | COC(=O)C1=NC(=C2C(=C1)C3=CC=CC=C3N2)[C@H](CO)O |
Computed by PubChem (NCBI)