CAS 75530-60-8 is the registry number for 4-(3-Nitrophenyl)-2-formyl-6-methyl-1,4-dihydropyridine-3,5-dicarboxylic Acid 5-Isopropyl Ester 3-Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
3-O-methyl 5-O-propan-2-yl 2-formyl-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 75530-60-8) is a chemical compound with the molecular formula C19H20N2O7 and a molecular weight of 388.4 g/mol. IUPAC name: 3-O-methyl 5-O-propan-2-yl 2-formyl-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: NOJOPYUNEHPTPL-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O7 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 3-O-methyl 5-O-propan-2-yl 2-formyl-6-methyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | NOJOPYUNEHPTPL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C=O)C(=O)OC)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC(C)C |
Computed by PubChem (NCBI)