Products 1061622-71-6
CAS 1061622-71-6 is the registry number for Methyl 4-(2-(benzylamino)acetamido)benzoate oxalate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-[[2-(benzylamino)acetyl]amino]benzoate;oxalic acid (CAS 1061622-71-6) is a chemical compound with the molecular formula C19H20N2O7 and a molecular weight of 388.4 g/mol. IUPAC name: methyl 4-[[2-(benzylamino)acetyl]amino]benzoate;oxalic acid. InChIKey: CUKOVGZWQPNZCV-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O7 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | methyl 4-[[2-(benzylamino)acetyl]amino]benzoate;oxalic acid |
| InChIKey | CUKOVGZWQPNZCV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)NC(=O)CNCC2=CC=CC=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)