CAS 328406-65-1 appears in our catalog under these names: (S)–NIFE, (S)-NIFE 97%, (S)-NIFE, 95.0%. Offered by: GLPBio, Ambeed, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 100mg, 250mg, 1g, 10 mg.
2-methoxyethyl (2S)-2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate (CAS 328406-65-1) is a chemical compound with the molecular formula C19H20N2O7 and a molecular weight of 388.4 g/mol. IUPAC name: 2-methoxyethyl (2S)-2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate. InChIKey: ZSOUYIBYVUBOGT-KRWDZBQOSA-N.
| Molecular formula | C19H20N2O7 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 2-methoxyethyl (2S)-2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate |
| InChIKey | ZSOUYIBYVUBOGT-KRWDZBQOSA-N |
| SMILES | COCCOC(=O)[C@H](CC1=CC=CC=C1)NC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)