Products 1270295-32-3
CAS 1270295-32-3 is the registry number for (R)-2-Methoxyethyl 2-(((4-nitrophenoxy)carbonyl)amino)-3-phenylpropanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
2-methoxyethyl (2R)-2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate (CAS 1270295-32-3) is a chemical compound with the molecular formula C19H20N2O7 and a molecular weight of 388.4 g/mol. IUPAC name: 2-methoxyethyl (2R)-2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate. InChIKey: ZSOUYIBYVUBOGT-QGZVFWFLSA-N.
| Molecular formula | C19H20N2O7 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 2-methoxyethyl (2R)-2-[(4-nitrophenoxy)carbonylamino]-3-phenylpropanoate |
| InChIKey | ZSOUYIBYVUBOGT-QGZVFWFLSA-N |
| SMILES | COCCOC(=O)[C@@H](CC1=CC=CC=C1)NC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)