CAS 75626-00-5 is the registry number for 2-(p-(2-Methyl-1,2-epoxypropyl)phenyl)propionic Acid. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
2-[4-(3,3-dimethyloxiran-2-yl)phenyl]propanoic acid (CAS 75626-00-5) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: 2-[4-(3,3-dimethyloxiran-2-yl)phenyl]propanoic acid. InChIKey: SKAHDOGTKBOBNX-UHFFFAOYSA-N.
| Molecular formula | C13H16O3 |
|---|---|
| Molecular weight | 220.26 g/mol |
| IUPAC name | 2-[4-(3,3-dimethyloxiran-2-yl)phenyl]propanoic acid |
| InChIKey | SKAHDOGTKBOBNX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C2C(O2)(C)C)C(=O)O |
Computed by PubChem (NCBI)