CAS 756486-14-3 appears in our catalog under these names: (S)–1–tert–Butyl 2–methyl 4–oxopiperidine–1,2–dicarboxylate, AN–12–H5 intermediate–2, AN-12-H5 intermediate-2 97%, AN-12-H5 intermediate-2, 98.70%, (S)-1-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylate, 97%. Offered by: GLPBio, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 10mM (in 1ml dmso), 50mg, 100g, 25g.
1-O-tert-butyl 2-O-methyl (2S)-4-oxopiperidine-1,2-dicarboxylate (CAS 756486-14-3) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4-oxopiperidine-1,2-dicarboxylate. InChIKey: ROHLQPZIUYTLGR-VIFPVBQESA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4-oxopiperidine-1,2-dicarboxylate |
| InChIKey | ROHLQPZIUYTLGR-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)