CAS 81357-18-8 appears in our catalog under these names: Methyl 1–Boc–4–oxopiperidine–2–carboxylate, 1-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylate, 1-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylate 95%, 1,2-Piperidinedicarboxylicacid, 4-oxo-, 1-(1,1-dimethylethyl) 2-methyl ester, 95%, 95%, 1-tert-Butyl 2-methyl 4-oxopiperidine-1,2-dicarboxylate, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 10g, 25g, 100mg, 5g, 100g, 500g.
1-O-tert-butyl 2-O-methyl 4-oxopiperidine-1,2-dicarboxylate (CAS 81357-18-8) is a chemical compound with the molecular formula C12H19NO5 and a molecular weight of 257.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 4-oxopiperidine-1,2-dicarboxylate. InChIKey: ROHLQPZIUYTLGR-UHFFFAOYSA-N.
| Molecular formula | C12H19NO5 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl 4-oxopiperidine-1,2-dicarboxylate |
| InChIKey | ROHLQPZIUYTLGR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)CC1C(=O)OC |
Computed by PubChem (NCBI)