Products 75655-45-7

CAS 75655-45-7 is the registry number for 3-(3-Methyl-2-oxo-2,3-dihydro-benzoimidazol-1-yl)-propionic acid. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

3-(3-methyl-2-oxobenzimidazol-1-yl)propanoic acid (CAS 75655-45-7) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: 3-(3-methyl-2-oxobenzimidazol-1-yl)propanoic acid. InChIKey: GKRUPQCGSGTQDB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12N2O3
Molecular weight220.22 g/mol
IUPAC name3-(3-methyl-2-oxobenzimidazol-1-yl)propanoic acid
InChIKeyGKRUPQCGSGTQDB-UHFFFAOYSA-N
SMILESCN1C2=CC=CC=C2N(C1=O)CCC(=O)O

Computed by PubChem (NCBI)