Products 756771-02-5
CAS 756771-02-5 is the registry number for Tetracaine-d6. Offered by: Chemat Brand. Available pack sizes: on request.
2-[bis(trideuteriomethyl)amino]ethyl 4-(butylamino)benzoate (CAS 756771-02-5) is a chemical compound with the molecular formula C15H24N2O2 and a molecular weight of 270.40 g/mol. IUPAC name: 2-[bis(trideuteriomethyl)amino]ethyl 4-(butylamino)benzoate. InChIKey: GKCBAIGFKIBETG-XERRXZQWSA-N.
| Molecular formula | C15H24N2O2 |
|---|---|
| Molecular weight | 270.40 g/mol |
| IUPAC name | 2-[bis(trideuteriomethyl)amino]ethyl 4-(butylamino)benzoate |
| InChIKey | GKCBAIGFKIBETG-XERRXZQWSA-N |
| SMILES | [2H]C([2H])([2H])N(CCOC(=O)C1=CC=C(C=C1)NCCCC)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)