Products 75828-06-7
CAS 75828-06-7 is the registry number for AMPA-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R,2S,4R)-2-ethynyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (CAS 75828-06-7) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: (1R,2S,4R)-2-ethynyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol. InChIKey: AXIWZGXZGAUBSU-YUSALJHKSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | (1R,2S,4R)-2-ethynyl-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| InChIKey | AXIWZGXZGAUBSU-YUSALJHKSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)C[C@@]2(C#C)O |
Computed by PubChem (NCBI)