Products 7585-47-9
CAS 7585-47-9 appears in our catalog under these names: (2S)-2-(Benzylamino)propanoic acid, 95%, (2S)-2-(Benzylamino)propanoic acid, Bzl-Ala-OH 95%, N-Benzyl-L-alanine, 95%, 95%, N-Benzyl-L-alanine, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 50mg, 25g, 10g.
(2S)-2-(benzylamino)propanoic acid (CAS 7585-47-9) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: (2S)-2-(benzylamino)propanoic acid. InChIKey: RLIHXKPTGKETCC-QMMMGPOBSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | (2S)-2-(benzylamino)propanoic acid |
| InChIKey | RLIHXKPTGKETCC-QMMMGPOBSA-N |
| SMILES | C[C@@H](C(=O)O)NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)