Products 75945-91-4
CAS 75945-91-4 appears in our catalog under these names: 4–oxo–1–Phenylcyclohexanecarboxylic acid, 4-oxo-1-Phenylcyclohexanecarboxylic acid, 4-Oxo-1-phenylcyclohexanecarboxylic acid, 96%, 4-Oxo-1-Phenylcyclohexanecarboxylic acid, 98%. Offered by: GLPBio, Biosynth, Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg, 2,5g, 10g, 5g.
4-oxo-1-phenylcyclohexane-1-carboxylic acid (CAS 75945-91-4) is a chemical compound with the molecular formula C13H14O3 and a molecular weight of 218.25 g/mol. IUPAC name: 4-oxo-1-phenylcyclohexane-1-carboxylic acid. InChIKey: GLXVJOPRMXBHSI-UHFFFAOYSA-N.
| Molecular formula | C13H14O3 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 4-oxo-1-phenylcyclohexane-1-carboxylic acid |
| InChIKey | GLXVJOPRMXBHSI-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)